C15H13ClN2O2S — CID 80645079
3-(3-chlorothiophen-2-yl)-4-(4-ethoxyphenyl)-1,2-oxazol-5-amine (PubChem CID 80645079) has the molecular formula C15H13ClN2O2S and a molecular weight of 320.80 g/mol. Its IUPAC name is 3-(3-chlorothiophen-2-yl)-4-(4-ethoxyphenyl)-1,2-oxazol-5-amine.
| Compound Name | 3-(3-chlorothiophen-2-yl)-4-(4-ethoxyphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 80645079 |
| Molecular Formula | C15H13ClN2O2S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 3-(3-chlorothiophen-2-yl)-4-(4-ethoxyphenyl)-1,2-oxazol-5-amine |
| SMILES | CCOc1ccc(-c2c(-c3sccc3Cl)noc2N)cc1 |
| InChI | InChI=1S/C15H13ClN2O2S/c1-2-19-10-5-3-9(4-6-10)12-13(18-20-15(12)17)14-11(16)7-8-21-14/h3-8H,2,17H2,1H3 |
| InChIKey | CHIRBYJCZWGXMD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |