C12H11F3N2O2 — CID 43336169
4-(4-ethoxyphenyl)-3-(trifluoromethyl)-1,2-oxazol-5-amine (PubChem CID 43336169) has the molecular formula C12H11F3N2O2 and a molecular weight of 272.23 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-3-(trifluoromethyl)-1,2-oxazol-5-amine.
| Compound Name | 4-(4-ethoxyphenyl)-3-(trifluoromethyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 43336169 |
| Molecular Formula | C12H11F3N2O2 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-(4-ethoxyphenyl)-3-(trifluoromethyl)-1,2-oxazol-5-amine |
| SMILES | CCOc1ccc(-c2c(C(F)(F)F)noc2N)cc1 |
| InChI | InChI=1S/C12H11F3N2O2/c1-2-18-8-5-3-7(4-6-8)9-10(12(13,14)15)17-19-11(9)16/h3-6H,2,16H2,1H3 |
| InChIKey | HFJPUGANMSENKX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |