C14H14ClFN2O2 — CID 66200709
4-(2-chloro-6-fluorophenyl)-5-(oxan-3-yl)-1,2-oxazol-3-amine (PubChem CID 66200709) has the molecular formula C14H14ClFN2O2 and a molecular weight of 296.73 g/mol. Its IUPAC name is 4-(2-chloro-6-fluorophenyl)-5-(oxan-3-yl)-1,2-oxazol-3-amine.
| Compound Name | 4-(2-chloro-6-fluorophenyl)-5-(oxan-3-yl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66200709 |
| Molecular Formula | C14H14ClFN2O2 |
| Molecular Weight | 296.73 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-(2-chloro-6-fluorophenyl)-5-(oxan-3-yl)-1,2-oxazol-3-amine |
| SMILES | Nc1noc(C2CCCOC2)c1-c1c(F)cccc1Cl |
| InChI | InChI=1S/C14H14ClFN2O2/c15-9-4-1-5-10(16)11(9)12-13(20-18-14(12)17)8-3-2-6-19-7-8/h1,4-5,8H,2-3,6-7H2,(H2,17,18) |
| InChIKey | VUVFBDQGNMTJAP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.73 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |