C14H10Cl2N2O2 — CID 66200956
4-(2,4-dichlorophenyl)-5-(3-methylfuran-2-yl)-1,2-oxazol-3-amine (PubChem CID 66200956) has the molecular formula C14H10Cl2N2O2 and a molecular weight of 309.15 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-5-(3-methylfuran-2-yl)-1,2-oxazol-3-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-5-(3-methylfuran-2-yl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66200956 |
| Molecular Formula | C14H10Cl2N2O2 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-5-(3-methylfuran-2-yl)-1,2-oxazol-3-amine |
| SMILES | Cc1ccoc1-c1onc(N)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl2N2O2/c1-7-4-5-19-12(7)13-11(14(17)18-20-13)9-3-2-8(15)6-10(9)16/h2-6H,1H3,(H2,17,18) |
| InChIKey | WDPNRUCETFYIOU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |