C16H8Cl4O — CID 163320542
2,3-bis(2,4-dichlorophenyl)furan (PubChem CID 163320542) has the molecular formula C16H8Cl4O and a molecular weight of 358.05 g/mol. Its IUPAC name is 2,3-bis(2,4-dichlorophenyl)furan.
| Compound Name | 2,3-bis(2,4-dichlorophenyl)furan |
|---|---|
| PubChem CID | 163320542 |
| Molecular Formula | C16H8Cl4O |
| Molecular Weight | 358.05 g/mol |
| Exact Mass | 355.93 |
| IUPAC Name | 2,3-bis(2,4-dichlorophenyl)furan |
| SMILES | Clc1ccc(-c2ccoc2-c2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H8Cl4O/c17-9-1-3-11(14(19)7-9)12-5-6-21-16(12)13-4-2-10(18)8-15(13)20/h1-8H |
| InChIKey | UBAMCIQFWYJOTA-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.05 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |