C13H7BrCl2N2O2 — CID 66200957
5-(5-bromofuran-2-yl)-4-(2,4-dichlorophenyl)-1,2-oxazol-3-amine (PubChem CID 66200957) has the molecular formula C13H7BrCl2N2O2 and a molecular weight of 374.02 g/mol. Its IUPAC name is 5-(5-bromofuran-2-yl)-4-(2,4-dichlorophenyl)-1,2-oxazol-3-amine.
| Compound Name | 5-(5-bromofuran-2-yl)-4-(2,4-dichlorophenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66200957 |
| Molecular Formula | C13H7BrCl2N2O2 |
| Molecular Weight | 374.02 g/mol |
| Exact Mass | 371.91 |
| IUPAC Name | 5-(5-bromofuran-2-yl)-4-(2,4-dichlorophenyl)-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2ccc(Br)o2)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H7BrCl2N2O2/c14-10-4-3-9(19-10)12-11(13(17)18-20-12)7-2-1-6(15)5-8(7)16/h1-5H,(H2,17,18) |
| InChIKey | ZJFHEAMBSCTJNY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.02 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |