C17H27N3 — CID 66201448
1-[1-[1-(2,5-dimethylphenyl)ethyl]azetidin-3-yl]piperazine (PubChem CID 66201448) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is 1-[1-[1-(2,5-dimethylphenyl)ethyl]azetidin-3-yl]piperazine.
| Compound Name | 1-[1-[1-(2,5-dimethylphenyl)ethyl]azetidin-3-yl]piperazine |
|---|---|
| PubChem CID | 66201448 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | 1-[1-[1-(2,5-dimethylphenyl)ethyl]azetidin-3-yl]piperazine |
| SMILES | Cc1ccc(C)c(C(C)N2CC(N3CCNCC3)C2)c1 |
| InChI | InChI=1S/C17H27N3/c1-13-4-5-14(2)17(10-13)15(3)20-11-16(12-20)19-8-6-18-7-9-19/h4-5,10,15-16,18H,6-9,11-12H2,1-3H3 |
| InChIKey | KITKECQGTCCDDH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |