C11H15NO4 — CID 66204925
2-amino-3-(3-ethoxyphenyl)-3-hydroxypropanoic acid (PubChem CID 66204925) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-amino-3-(3-ethoxyphenyl)-3-hydroxypropanoic acid.
| Compound Name | 2-amino-3-(3-ethoxyphenyl)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 66204925 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-amino-3-(3-ethoxyphenyl)-3-hydroxypropanoic acid |
| SMILES | CCOc1cccc(C(O)C(N)C(=O)O)c1 |
| InChI | InChI=1S/C11H15NO4/c1-2-16-8-5-3-4-7(6-8)10(13)9(12)11(14)15/h3-6,9-10,13H,2,12H2,1H3,(H,14,15) |
| InChIKey | KAOSVPPWPUGOEJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |