C13H16FN3O — CID 66210843
N-(4-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 66210843) has the molecular formula C13H16FN3O and a molecular weight of 249.29 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | N-(4-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 66210843 |
| Molecular Formula | C13H16FN3O |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | N-(4-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)N1CC2CNCC2C1 |
| InChI | InChI=1S/C13H16FN3O/c14-11-1-3-12(4-2-11)16-13(18)17-7-9-5-15-6-10(9)8-17/h1-4,9-10,15H,5-8H2,(H,16,18) |
| InChIKey | NTTHWMMRGVPEHT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |