C10H14N4O4S — CID 66213601
2-(4-formyltriazol-1-yl)-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide (PubChem CID 66213601) has the molecular formula C10H14N4O4S and a molecular weight of 286.31 g/mol. Its IUPAC name is 2-(4-formyltriazol-1-yl)-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-(4-formyltriazol-1-yl)-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 66213601 |
| Molecular Formula | C10H14N4O4S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-(4-formyltriazol-1-yl)-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide |
| SMILES | CC1(NC(=O)Cn2cc(C=O)nn2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H14N4O4S/c1-10(2-3-19(17,18)7-10)11-9(16)5-14-4-8(6-15)12-13-14/h4,6H,2-3,5,7H2,1H3,(H,11,16) |
| InChIKey | CRRIKCUVRVQIGN-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|