C20H24N6O2 — CID 662147
ethyl 4-[4-(dimethylamino)anilino]-2-(3,5-dimethylpyrazol-1-yl)pyrimidine-5-carboxylate (PubChem CID 662147) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is ethyl 4-[4-(dimethylamino)anilino]-2-(3,5-dimethylpyrazol-1-yl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[4-(dimethylamino)anilino]-2-(3,5-dimethylpyrazol-1-yl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 662147 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | ethyl 4-[4-(dimethylamino)anilino]-2-(3,5-dimethylpyrazol-1-yl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-n2nc(C)cc2C)nc1Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H24N6O2/c1-6-28-19(27)17-12-21-20(26-14(3)11-13(2)24-26)23-18(17)22-15-7-9-16(10-8-15)25(4)5/h7-12H,6H2,1-5H3,(H,21,22,23) |
| InChIKey | PRSDSEXRDGXJPO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|