C18H19N5O3 — CID 1968565
2-(3,5-Dimethyl-1-pyrazolyl)-4-(4-hydroxyanilino)-5-pyrimidinecarboxylic acid ethyl ester (PubChem CID 1968565) has the molecular formula C18H19N5O3 and a molecular weight of 353.40 g/mol. Its IUPAC name is ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-(4-hydroxyanilino)pyrimidine-5-carboxylate.
| Compound Name | 2-(3,5-Dimethyl-1-pyrazolyl)-4-(4-hydroxyanilino)-5-pyrimidinecarboxylic acid ethyl ester |
|---|---|
| PubChem CID | 1968565 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-(4-hydroxyanilino)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=CN=C(N=C1NC2=CC=C(C=C2)O)N3C(=CC(=N3)C)C |
| InChI | InChI=1S/C18H19N5O3/c1-4-26-17(25)15-10-19-18(23-12(3)9-11(2)22-23)21-16(15)20-13-5-7-14(24)8-6-13/h5-10,24H,4H2,1-3H3,(H,19,20,21) |
| InChIKey | JLQSDPUKMIJEII-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 102.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | 472 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|