C27H31N5O3 — CID 6918789
ethyl 4-[3-(diethylaminomethyl)-4-hydroxyanilino]-3-methyl-1-phenylpyrazolo[3,4-b]pyridine-5-carboxylate (PubChem CID 6918789) has the molecular formula C27H31N5O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is ethyl 4-[3-(diethylaminomethyl)-4-hydroxyanilino]-3-methyl-1-phenylpyrazolo[3,4-b]pyridine-5-carboxylate.
| Compound Name | ethyl 4-[3-(diethylaminomethyl)-4-hydroxyanilino]-3-methyl-1-phenylpyrazolo[3,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 6918789 |
| Molecular Formula | C27H31N5O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | ethyl 4-[3-(diethylaminomethyl)-4-hydroxyanilino]-3-methyl-1-phenylpyrazolo[3,4-b]pyridine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(c(C)nn2-c2ccccc2)c1Nc1ccc(O)c(CN(CC)CC)c1 |
| InChI | InChI=1S/C27H31N5O3/c1-5-31(6-2)17-19-15-20(13-14-23(19)33)29-25-22(27(34)35-7-3)16-28-26-24(25)18(4)30-32(26)21-11-9-8-10-12-21/h8-16,33H,5-7,17H2,1-4H3,(H,28,29) |
| InChIKey | NFQXLMGYJDIOMQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|