C22H18N2O2S — CID 6621724
6-methoxy-N-phenyl-N-prop-2-enylthieno[2,3-b]quinoline-2-carboxamide (PubChem CID 6621724) has the molecular formula C22H18N2O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is 6-methoxy-N-phenyl-N-prop-2-enylthieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | 6-methoxy-N-phenyl-N-prop-2-enylthieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 6621724 |
| Molecular Formula | C22H18N2O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 6-methoxy-N-phenyl-N-prop-2-enylthieno[2,3-b]quinoline-2-carboxamide |
| SMILES | C=CCN(C(=O)c1cc2cc3cc(OC)ccc3nc2s1)c1ccccc1 |
| InChI | InChI=1S/C22H18N2O2S/c1-3-11-24(17-7-5-4-6-8-17)22(25)20-14-16-12-15-13-18(26-2)9-10-19(15)23-21(16)27-20/h3-10,12-14H,1,11H2,2H3 |
| InChIKey | RYDWYBQMTBEKJD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|