C10H15NO3S — CID 66217884
methyl 2-(1-aminopropan-2-ylsulfanylmethyl)furan-3-carboxylate (PubChem CID 66217884) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is methyl 2-(1-aminopropan-2-ylsulfanylmethyl)furan-3-carboxylate.
| Compound Name | methyl 2-(1-aminopropan-2-ylsulfanylmethyl)furan-3-carboxylate |
|---|---|
| PubChem CID | 66217884 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | methyl 2-(1-aminopropan-2-ylsulfanylmethyl)furan-3-carboxylate |
| SMILES | COC(=O)c1ccoc1CSC(C)CN |
| InChI | InChI=1S/C10H15NO3S/c1-7(5-11)15-6-9-8(3-4-14-9)10(12)13-2/h3-4,7H,5-6,11H2,1-2H3 |
| InChIKey | VTJPKHIUZMLMPL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |