C12H14F3NOS — CID 66218272
3-[4-(trifluoromethoxy)phenyl]-1,4-thiazepane (PubChem CID 66218272) has the molecular formula C12H14F3NOS and a molecular weight of 277.31 g/mol. Its IUPAC name is 3-[4-(trifluoromethoxy)phenyl]-1,4-thiazepane.
| Compound Name | 3-[4-(trifluoromethoxy)phenyl]-1,4-thiazepane |
|---|---|
| PubChem CID | 66218272 |
| Molecular Formula | C12H14F3NOS |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 3-[4-(trifluoromethoxy)phenyl]-1,4-thiazepane |
| SMILES | FC(F)(F)Oc1ccc(C2CSCCCN2)cc1 |
| InChI | InChI=1S/C12H14F3NOS/c13-12(14,15)17-10-4-2-9(3-5-10)11-8-18-7-1-6-16-11/h2-5,11,16H,1,6-8H2 |
| InChIKey | RCEBFRHFZCZLJF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |