C7H16O3S — CID 66222196
1-(2,2-dimethoxyethylsulfinyl)propane (PubChem CID 66222196) has the molecular formula C7H16O3S and a molecular weight of 180.27 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethylsulfinyl)propane.
| Compound Name | 1-(2,2-dimethoxyethylsulfinyl)propane |
|---|---|
| PubChem CID | 66222196 |
| Molecular Formula | C7H16O3S |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 1-(2,2-dimethoxyethylsulfinyl)propane |
| SMILES | CCCS(=O)CC(OC)OC |
| InChI | InChI=1S/C7H16O3S/c1-4-5-11(8)6-7(9-2)10-3/h7H,4-6H2,1-3H3 |
| InChIKey | MODAWNGSCRNWLF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|