C10H9IN2S — CID 66223467
[4-(5-iodo-1,3-thiazol-2-yl)phenyl]methanamine (PubChem CID 66223467) has the molecular formula C10H9IN2S and a molecular weight of 316.17 g/mol. Its IUPAC name is [4-(5-iodo-1,3-thiazol-2-yl)phenyl]methanamine.
| Compound Name | [4-(5-iodo-1,3-thiazol-2-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 66223467 |
| Molecular Formula | C10H9IN2S |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 315.95 |
| IUPAC Name | [4-(5-iodo-1,3-thiazol-2-yl)phenyl]methanamine |
| SMILES | NCc1ccc(-c2ncc(I)s2)cc1 |
| InChI | InChI=1S/C10H9IN2S/c11-9-6-13-10(14-9)8-3-1-7(5-12)2-4-8/h1-4,6H,5,12H2 |
| InChIKey | SLLVZHNODZDROU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|