C13H21N3O2S — CID 66224722
3-[2-(3-amino-2-methylpropyl)sulfanylethoxy]benzohydrazide (PubChem CID 66224722) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 3-[2-(3-amino-2-methylpropyl)sulfanylethoxy]benzohydrazide.
| Compound Name | 3-[2-(3-amino-2-methylpropyl)sulfanylethoxy]benzohydrazide |
|---|---|
| PubChem CID | 66224722 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 3-[2-(3-amino-2-methylpropyl)sulfanylethoxy]benzohydrazide |
| SMILES | CC(CN)CSCCOc1cccc(C(=O)NN)c1 |
| InChI | InChI=1S/C13H21N3O2S/c1-10(8-14)9-19-6-5-18-12-4-2-3-11(7-12)13(17)16-15/h2-4,7,10H,5-6,8-9,14-15H2,1H3,(H,16,17) |
| InChIKey | HIXNNAPHWPQHEY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|