C23H26N2O3 — CID 6622707
4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]-N-(2-phenylethyl)butanamide (PubChem CID 6622707) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]-N-(2-phenylethyl)butanamide.
| Compound Name | 4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]-N-(2-phenylethyl)butanamide |
|---|---|
| PubChem CID | 6622707 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]-N-(2-phenylethyl)butanamide |
| SMILES | CCOc1ccc(-c2cc(CCCC(=O)NCCc3ccccc3)no2)cc1 |
| InChI | InChI=1S/C23H26N2O3/c1-2-27-21-13-11-19(12-14-21)22-17-20(25-28-22)9-6-10-23(26)24-16-15-18-7-4-3-5-8-18/h3-5,7-8,11-14,17H,2,6,9-10,15-16H2,1H3,(H,24,26) |
| InChIKey | ZUAPPDJPQGNNOO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |