C14H27NOS — CID 66227831
7-tert-butyl-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine 1-oxide (PubChem CID 66227831) has the molecular formula C14H27NOS and a molecular weight of 257.44 g/mol. Its IUPAC name is 7-tert-butyl-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine 1-oxide.
| Compound Name | 7-tert-butyl-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine 1-oxide |
|---|---|
| PubChem CID | 66227831 |
| Molecular Formula | C14H27NOS |
| Molecular Weight | 257.44 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 7-tert-butyl-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine 1-oxide |
| SMILES | CC1(C)CS(=O)C2CC(C(C)(C)C)CCC2N1 |
| InChI | InChI=1S/C14H27NOS/c1-13(2,3)10-6-7-11-12(8-10)17(16)9-14(4,5)15-11/h10-12,15H,6-9H2,1-5H3 |
| InChIKey | XMTSKVBEOFQHFX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |