C15H23NOS — CID 66228672
3-ethyl-5-(4-propan-2-ylphenyl)-1,4-thiazinane 1-oxide (PubChem CID 66228672) has the molecular formula C15H23NOS and a molecular weight of 265.42 g/mol. Its IUPAC name is 3-ethyl-5-(4-propan-2-ylphenyl)-1,4-thiazinane 1-oxide.
| Compound Name | 3-ethyl-5-(4-propan-2-ylphenyl)-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 66228672 |
| Molecular Formula | C15H23NOS |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 3-ethyl-5-(4-propan-2-ylphenyl)-1,4-thiazinane 1-oxide |
| SMILES | CCC1CS(=O)CC(c2ccc(C(C)C)cc2)N1 |
| InChI | InChI=1S/C15H23NOS/c1-4-14-9-18(17)10-15(16-14)13-7-5-12(6-8-13)11(2)3/h5-8,11,14-16H,4,9-10H2,1-3H3 |
| InChIKey | IHCHVOUZSOJPHF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |