C12H11N3O2 — CID 6623181
2,3-dihydro-1,4-benzoxazin-4-yl(imidazol-1-yl)methanone (PubChem CID 6623181) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzoxazin-4-yl(imidazol-1-yl)methanone.
| Compound Name | 2,3-dihydro-1,4-benzoxazin-4-yl(imidazol-1-yl)methanone |
|---|---|
| PubChem CID | 6623181 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2,3-dihydro-1,4-benzoxazin-4-yl(imidazol-1-yl)methanone |
| SMILES | O=C(N1CCOc2ccccc21)n1ccnc1 |
| InChI | InChI=1S/C12H11N3O2/c16-12(14-6-5-13-9-14)15-7-8-17-11-4-2-1-3-10(11)15/h1-6,9H,7-8H2 |
| InChIKey | PVQZIHAKZDDRLZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |