C19H27NO — CID 66232471
2-(3,3-dimethylbutoxy)-N-methyl-1-naphthalen-1-ylethanamine (PubChem CID 66232471) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is 2-(3,3-dimethylbutoxy)-N-methyl-1-naphthalen-1-ylethanamine.
| Compound Name | 2-(3,3-dimethylbutoxy)-N-methyl-1-naphthalen-1-ylethanamine |
|---|---|
| PubChem CID | 66232471 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 2-(3,3-dimethylbutoxy)-N-methyl-1-naphthalen-1-ylethanamine |
| SMILES | CNC(COCCC(C)(C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H27NO/c1-19(2,3)12-13-21-14-18(20-4)17-11-7-9-15-8-5-6-10-16(15)17/h5-11,18,20H,12-14H2,1-4H3 |
| InChIKey | WVTWASCILWIMDI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|