C17H29NO — CID 66232695
2-(3,3-dimethylbutoxy)-1-(3,4-dimethylphenyl)-N-methylethanamine (PubChem CID 66232695) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is 2-(3,3-dimethylbutoxy)-1-(3,4-dimethylphenyl)-N-methylethanamine.
| Compound Name | 2-(3,3-dimethylbutoxy)-1-(3,4-dimethylphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 66232695 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 2-(3,3-dimethylbutoxy)-1-(3,4-dimethylphenyl)-N-methylethanamine |
| SMILES | CNC(COCCC(C)(C)C)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H29NO/c1-13-7-8-15(11-14(13)2)16(18-6)12-19-10-9-17(3,4)5/h7-8,11,16,18H,9-10,12H2,1-6H3 |
| InChIKey | VCOSSUJEOZBGRK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|