C15H23NOS — CID 66233988
3-(4-ethylphenyl)-2,5-dimethyl-1,4-thiazepane 1-oxide (PubChem CID 66233988) has the molecular formula C15H23NOS and a molecular weight of 265.42 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-2,5-dimethyl-1,4-thiazepane 1-oxide.
| Compound Name | 3-(4-ethylphenyl)-2,5-dimethyl-1,4-thiazepane 1-oxide |
|---|---|
| PubChem CID | 66233988 |
| Molecular Formula | C15H23NOS |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 3-(4-ethylphenyl)-2,5-dimethyl-1,4-thiazepane 1-oxide |
| SMILES | CCc1ccc(C2NC(C)CCS(=O)C2C)cc1 |
| InChI | InChI=1S/C15H23NOS/c1-4-13-5-7-14(8-6-13)15-12(3)18(17)10-9-11(2)16-15/h5-8,11-12,15-16H,4,9-10H2,1-3H3 |
| InChIKey | RMEAMBRIRWCCJS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |