C13H16F3NO2S — CID 66234430
5-methyl-3-[4-(trifluoromethoxy)phenyl]-1,4-thiazepane 1-oxide (PubChem CID 66234430) has the molecular formula C13H16F3NO2S and a molecular weight of 307.34 g/mol. Its IUPAC name is 5-methyl-3-[4-(trifluoromethoxy)phenyl]-1,4-thiazepane 1-oxide.
| Compound Name | 5-methyl-3-[4-(trifluoromethoxy)phenyl]-1,4-thiazepane 1-oxide |
|---|---|
| PubChem CID | 66234430 |
| Molecular Formula | C13H16F3NO2S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 5-methyl-3-[4-(trifluoromethoxy)phenyl]-1,4-thiazepane 1-oxide |
| SMILES | CC1CCS(=O)CC(c2ccc(OC(F)(F)F)cc2)N1 |
| InChI | InChI=1S/C13H16F3NO2S/c1-9-6-7-20(18)8-12(17-9)10-2-4-11(5-3-10)19-13(14,15)16/h2-5,9,12,17H,6-8H2,1H3 |
| InChIKey | LAOZVMXPEDMFQM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |