C14H20N6 — CID 66242174
7-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 66242174) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is 7-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 66242174 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 7-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc(N2CC3CNCC3C2(C)C)n2ncnc2n1 |
| InChI | InChI=1S/C14H20N6/c1-9-4-12(20-13(18-9)16-8-17-20)19-7-10-5-15-6-11(10)14(19,2)3/h4,8,10-11,15H,5-7H2,1-3H3 |
| InChIKey | SLNMEKSGFMFQEA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |