C10H12ClF2NO5S2 — CID 66243261
5-[1-(difluoromethylsulfonylamino)ethyl]-2-methoxybenzenesulfonyl chloride (PubChem CID 66243261) has the molecular formula C10H12ClF2NO5S2 and a molecular weight of 363.79 g/mol. Its IUPAC name is 5-[1-(difluoromethylsulfonylamino)ethyl]-2-methoxybenzenesulfonyl chloride.
| Compound Name | 5-[1-(difluoromethylsulfonylamino)ethyl]-2-methoxybenzenesulfonyl chloride |
|---|---|
| PubChem CID | 66243261 |
| Molecular Formula | C10H12ClF2NO5S2 |
| Molecular Weight | 363.79 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | 5-[1-(difluoromethylsulfonylamino)ethyl]-2-methoxybenzenesulfonyl chloride |
| SMILES | COc1ccc(C(C)NS(=O)(=O)C(F)F)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H12ClF2NO5S2/c1-6(14-21(17,18)10(12)13)7-3-4-8(19-2)9(5-7)20(11,15)16/h3-6,10,14H,1-2H3 |
| InChIKey | ISBFSRUOXMZDHJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.79 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |