C15H18BrFN2O — CID 66243971
(2-bromo-4-fluorophenyl)-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone (PubChem CID 66243971) has the molecular formula C15H18BrFN2O and a molecular weight of 341.22 g/mol. Its IUPAC name is (2-bromo-4-fluorophenyl)-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone.
| Compound Name | (2-bromo-4-fluorophenyl)-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone |
|---|---|
| PubChem CID | 66243971 |
| Molecular Formula | C15H18BrFN2O |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | (2-bromo-4-fluorophenyl)-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone |
| SMILES | CC1(C)C2CNCC2CN1C(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C15H18BrFN2O/c1-15(2)12-7-18-6-9(12)8-19(15)14(20)11-4-3-10(17)5-13(11)16/h3-5,9,12,18H,6-8H2,1-2H3 |
| InChIKey | HHJCXCKSHLYUJV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |