C13H22N2O3 — CID 66245119
4-[(3-cyano-3-methylbutyl)-ethylamino]oxolane-3-carboxylic acid (PubChem CID 66245119) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-[(3-cyano-3-methylbutyl)-ethylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(3-cyano-3-methylbutyl)-ethylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66245119 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 4-[(3-cyano-3-methylbutyl)-ethylamino]oxolane-3-carboxylic acid |
| SMILES | CCN(CCC(C)(C)C#N)C1COCC1C(=O)O |
| InChI | InChI=1S/C13H22N2O3/c1-4-15(6-5-13(2,3)9-14)11-8-18-7-10(11)12(16)17/h10-11H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | JYQQJWLONNXKGN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |