C25H24N2O4 — CID 6624604
methyl 4-[6-(2-hydroxyphenyl)-4-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-2-yl]benzoate (PubChem CID 6624604) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is methyl 4-[6-(2-hydroxyphenyl)-4-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-2-yl]benzoate.
| Compound Name | methyl 4-[6-(2-hydroxyphenyl)-4-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-2-yl]benzoate |
|---|---|
| PubChem CID | 6624604 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | methyl 4-[6-(2-hydroxyphenyl)-4-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2N=C(c3cccc(OC)c3)CC(c3ccccc3O)N2)cc1 |
| InChI | InChI=1S/C25H24N2O4/c1-30-19-7-5-6-18(14-19)21-15-22(20-8-3-4-9-23(20)28)27-24(26-21)16-10-12-17(13-11-16)25(29)31-2/h3-14,22,24,27-28H,15H2,1-2H3 |
| InChIKey | NGGFYPRROHKQIF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|