C27H28N2O5 — CID 94486062
methyl 4-[(2S,6S)-6-(3-ethoxy-2-hydroxyphenyl)-4-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-2-yl]benzoate (PubChem CID 94486062) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is methyl 4-[(2S,6S)-6-(3-ethoxy-2-hydroxyphenyl)-4-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2S,6S)-6-(3-ethoxy-2-hydroxyphenyl)-4-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-2-yl]benzoate |
|---|---|
| PubChem CID | 94486062 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | methyl 4-[(2S,6S)-6-(3-ethoxy-2-hydroxyphenyl)-4-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-2-yl]benzoate |
| SMILES | CCOc1cccc([C@@H]2CC(c3cccc(OC)c3)=N[C@@H](c3ccc(C(=O)OC)cc3)N2)c1O |
| InChI | InChI=1S/C27H28N2O5/c1-4-34-24-10-6-9-21(25(24)30)23-16-22(19-7-5-8-20(15-19)32-2)28-26(29-23)17-11-13-18(14-12-17)27(31)33-3/h5-15,23,26,29-30H,4,16H2,1-3H3/t23-,26+/m0/s1 |
| InChIKey | KXUOCGXHWTUTEN-JYFHCDHNSA-N |
| XLogP | 4.81 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|