C25H24ClN3O5 — CID 92698299
2-[(2R,6S)-2-(4-chloro-3-nitrophenyl)-4-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-ethoxyphenol (PubChem CID 92698299) has the molecular formula C25H24ClN3O5 and a molecular weight of 481.94 g/mol. Its IUPAC name is 2-[(2R,6S)-2-(4-chloro-3-nitrophenyl)-4-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-ethoxyphenol.
| Compound Name | 2-[(2R,6S)-2-(4-chloro-3-nitrophenyl)-4-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 92698299 |
| Molecular Formula | C25H24ClN3O5 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 2-[(2R,6S)-2-(4-chloro-3-nitrophenyl)-4-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-ethoxyphenol |
| SMILES | CCOc1cccc([C@@H]2CC(c3cccc(OC)c3)=N[C@H](c3ccc(Cl)c([N+](=O)[O-])c3)N2)c1O |
| InChI | InChI=1S/C25H24ClN3O5/c1-3-34-23-9-5-8-18(24(23)30)21-14-20(15-6-4-7-17(12-15)33-2)27-25(28-21)16-10-11-19(26)22(13-16)29(31)32/h4-13,21,25,28,30H,3,14H2,1-2H3/t21-,25-/m0/s1 |
| InChIKey | GGBZJDAOGCYXSZ-OFVILXPXSA-N |
| XLogP | 5.58 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|