C11H16N2O7 — CID 66262675
(2S)-1-[2-[(1-carboxy-2-hydroxyethyl)amino]-2-oxoacetyl]piperidine-2-carboxylic acid (PubChem CID 66262675) has the molecular formula C11H16N2O7 and a molecular weight of 288.26 g/mol. Its IUPAC name is (2S)-1-[2-[(1-carboxy-2-hydroxyethyl)amino]-2-oxoacetyl]piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-[(1-carboxy-2-hydroxyethyl)amino]-2-oxoacetyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 66262675 |
| Molecular Formula | C11H16N2O7 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (2S)-1-[2-[(1-carboxy-2-hydroxyethyl)amino]-2-oxoacetyl]piperidine-2-carboxylic acid |
| SMILES | O=C(NC(CO)C(=O)O)C(=O)N1CCCC[C@H]1C(=O)O |
| InChI | InChI=1S/C11H16N2O7/c14-5-6(10(17)18)12-8(15)9(16)13-4-2-1-3-7(13)11(19)20/h6-7,14H,1-5H2,(H,12,15)(H,17,18)(H,19,20)/t6?,7-/m0/s1 |
| InChIKey | RFVADSOTTQQGME-MLWJPKLSSA-N |
| XLogP | -1.99 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|