C11H16N2O6 — CID 79034718
(2R)-1-[2-(2-carboxyethylamino)-2-oxoacetyl]piperidine-2-carboxylic acid (PubChem CID 79034718) has the molecular formula C11H16N2O6 and a molecular weight of 272.26 g/mol. Its IUPAC name is (2R)-1-[2-(2-carboxyethylamino)-2-oxoacetyl]piperidine-2-carboxylic acid.
| Compound Name | (2R)-1-[2-(2-carboxyethylamino)-2-oxoacetyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 79034718 |
| Molecular Formula | C11H16N2O6 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (2R)-1-[2-(2-carboxyethylamino)-2-oxoacetyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)CCNC(=O)C(=O)N1CCCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C11H16N2O6/c14-8(15)4-5-12-9(16)10(17)13-6-2-1-3-7(13)11(18)19/h7H,1-6H2,(H,12,16)(H,14,15)(H,18,19)/t7-/m1/s1 |
| InChIKey | NMUWVFPLZALSRN-SSDOTTSWSA-N |
| XLogP | -0.96 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|