C12H18N2O7 — CID 79463023
(2R)-1-[2-[2-(carboxymethoxy)ethylamino]-2-oxoacetyl]piperidine-2-carboxylic acid (PubChem CID 79463023) has the molecular formula C12H18N2O7 and a molecular weight of 302.28 g/mol. Its IUPAC name is (2R)-1-[2-[2-(carboxymethoxy)ethylamino]-2-oxoacetyl]piperidine-2-carboxylic acid.
| Compound Name | (2R)-1-[2-[2-(carboxymethoxy)ethylamino]-2-oxoacetyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 79463023 |
| Molecular Formula | C12H18N2O7 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (2R)-1-[2-[2-(carboxymethoxy)ethylamino]-2-oxoacetyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)COCCNC(=O)C(=O)N1CCCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C12H18N2O7/c15-9(16)7-21-6-4-13-10(17)11(18)14-5-2-1-3-8(14)12(19)20/h8H,1-7H2,(H,13,17)(H,15,16)(H,19,20)/t8-/m1/s1 |
| InChIKey | LWIXTZVFQGRWDE-MRVPVSSYSA-N |
| XLogP | -1.33 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|