C13H18N2O6 — CID 81155833
(2R)-1-[2-[(1-carboxycyclobutyl)amino]-2-oxoacetyl]piperidine-2-carboxylic acid (PubChem CID 81155833) has the molecular formula C13H18N2O6 and a molecular weight of 298.30 g/mol. Its IUPAC name is (2R)-1-[2-[(1-carboxycyclobutyl)amino]-2-oxoacetyl]piperidine-2-carboxylic acid.
| Compound Name | (2R)-1-[2-[(1-carboxycyclobutyl)amino]-2-oxoacetyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 81155833 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (2R)-1-[2-[(1-carboxycyclobutyl)amino]-2-oxoacetyl]piperidine-2-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCC1)C(=O)N1CCCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C13H18N2O6/c16-9(14-13(12(20)21)5-3-6-13)10(17)15-7-2-1-4-8(15)11(18)19/h8H,1-7H2,(H,14,16)(H,18,19)(H,20,21)/t8-/m1/s1 |
| InChIKey | FYWVWWBAVLLBSH-MRVPVSSYSA-N |
| XLogP | -0.42 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|