C13H20N4OS — CID 66268505
2-[4-[[1-(5-methylthiophen-2-yl)propan-2-ylamino]methyl]triazol-1-yl]ethanol (PubChem CID 66268505) has the molecular formula C13H20N4OS and a molecular weight of 280.40 g/mol. Its IUPAC name is 2-[4-[[1-(5-methylthiophen-2-yl)propan-2-ylamino]methyl]triazol-1-yl]ethanol.
| Compound Name | 2-[4-[[1-(5-methylthiophen-2-yl)propan-2-ylamino]methyl]triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 66268505 |
| Molecular Formula | C13H20N4OS |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-[4-[[1-(5-methylthiophen-2-yl)propan-2-ylamino]methyl]triazol-1-yl]ethanol |
| SMILES | Cc1ccc(CC(C)NCc2cn(CCO)nn2)s1 |
| InChI | InChI=1S/C13H20N4OS/c1-10(7-13-4-3-11(2)19-13)14-8-12-9-17(5-6-18)16-15-12/h3-4,9-10,14,18H,5-8H2,1-2H3 |
| InChIKey | PBDNZJALXUSPJH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |