C13H10F3N5 — CID 66269737
2-(7-methyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)-4-(trifluoromethyl)aniline (PubChem CID 66269737) has the molecular formula C13H10F3N5 and a molecular weight of 293.25 g/mol. Its IUPAC name is 2-(7-methyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)-4-(trifluoromethyl)aniline.
| Compound Name | 2-(7-methyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 66269737 |
| Molecular Formula | C13H10F3N5 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-(7-methyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)-4-(trifluoromethyl)aniline |
| SMILES | Cc1cc2nnc(-c3cc(C(F)(F)F)ccc3N)n2cn1 |
| InChI | InChI=1S/C13H10F3N5/c1-7-4-11-19-20-12(21(11)6-18-7)9-5-8(13(14,15)16)2-3-10(9)17/h2-6H,17H2,1H3 |
| InChIKey | BTWTUIFWXMBTEU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|