C13H19FN2 — CID 66273075
N-(3-fluorophenyl)-N,4-dimethylpiperidin-3-amine (PubChem CID 66273075) has the molecular formula C13H19FN2 and a molecular weight of 222.31 g/mol. Its IUPAC name is N-(3-fluorophenyl)-N,4-dimethylpiperidin-3-amine.
| Compound Name | N-(3-fluorophenyl)-N,4-dimethylpiperidin-3-amine |
|---|---|
| PubChem CID | 66273075 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | N-(3-fluorophenyl)-N,4-dimethylpiperidin-3-amine |
| SMILES | CC1CCNCC1N(C)c1cccc(F)c1 |
| InChI | InChI=1S/C13H19FN2/c1-10-6-7-15-9-13(10)16(2)12-5-3-4-11(14)8-12/h3-5,8,10,13,15H,6-7,9H2,1-2H3 |
| InChIKey | NCYKGHKTACLEOD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |