About [6-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]methanamine
[6-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]methanamine (PubChem CID 66275408) has the molecular formula C9H11F3N2O
and a molecular weight of 220.19 g/mol. Its IUPAC name is [6-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [6-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]methanamine |
| PubChem CID | 66275408 |
| Molecular Formula | C9H11F3N2O |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | [6-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]methanamine |
| SMILES | CC(Oc1cccc(CN)n1)C(F)(F)F |
| InChI | InChI=1S/C9H11F3N2O/c1-6(9(10,11)12)15-8-4-2-3-7(5-13)14-8/h2-4,6H,5,13H2,1H3 |
| InChIKey | DFEOEXKDUYHCDO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [6-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]methanamine?
The IUPAC name of [6-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]methanamine (CID 66275408) is [6-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]methanamine.
What is the SMILES notation for [6-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]methanamine?
The canonical SMILES for [6-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]methanamine is CC(Oc1cccc(CN)n1)C(F)(F)F.
What is the InChIKey of [6-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]methanamine?
The InChIKey is DFEOEXKDUYHCDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3N2O/c1-6(9(10,11)12)15-8-4-2-3-7(5-13)14-8/h2-4,6H,5,13H2,1H3.
What are the key properties of [6-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]methanamine?
[6-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]methanamine has a molecular weight of 220.19 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]methanamine is sourced from PubChem (CID 66275408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).