C13H21N3 — CID 66279507
5-methyl-2-N-(4-methylcyclohexyl)pyridine-2,3-diamine (PubChem CID 66279507) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 5-methyl-2-N-(4-methylcyclohexyl)pyridine-2,3-diamine.
| Compound Name | 5-methyl-2-N-(4-methylcyclohexyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 66279507 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 5-methyl-2-N-(4-methylcyclohexyl)pyridine-2,3-diamine |
| SMILES | Cc1cnc(NC2CCC(C)CC2)c(N)c1 |
| InChI | InChI=1S/C13H21N3/c1-9-3-5-11(6-4-9)16-13-12(14)7-10(2)8-15-13/h7-9,11H,3-6,14H2,1-2H3,(H,15,16) |
| InChIKey | ZXKFWDLZEFVBSP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |