C10H14ClN3 — CID 58171612
5-chloro-2-N-cyclopentylpyridine-2,3-diamine (PubChem CID 58171612) has the molecular formula C10H14ClN3 and a molecular weight of 211.70 g/mol. Its IUPAC name is 5-chloro-2-N-cyclopentylpyridine-2,3-diamine.
| Compound Name | 5-chloro-2-N-cyclopentylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 58171612 |
| Molecular Formula | C10H14ClN3 |
| Molecular Weight | 211.70 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 5-chloro-2-N-cyclopentylpyridine-2,3-diamine |
| SMILES | Nc1cc(Cl)cnc1NC1CCCC1 |
| InChI | InChI=1S/C10H14ClN3/c11-7-5-9(12)10(13-6-7)14-8-3-1-2-4-8/h5-6,8H,1-4,12H2,(H,13,14) |
| InChIKey | FDVGJASVZDZUTO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.70 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |