C8H11ClN4 — CID 91239284
5-chloro-2-N-cyclopropylpyridine-2,3,4-triamine (PubChem CID 91239284) has the molecular formula C8H11ClN4 and a molecular weight of 198.66 g/mol. Its IUPAC name is 5-chloro-2-N-cyclopropylpyridine-2,3,4-triamine.
| Compound Name | 5-chloro-2-N-cyclopropylpyridine-2,3,4-triamine |
|---|---|
| PubChem CID | 91239284 |
| Molecular Formula | C8H11ClN4 |
| Molecular Weight | 198.66 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 5-chloro-2-N-cyclopropylpyridine-2,3,4-triamine |
| SMILES | Nc1c(Cl)cnc(NC2CC2)c1N |
| InChI | InChI=1S/C8H11ClN4/c9-5-3-12-8(7(11)6(5)10)13-4-1-2-4/h3-4H,1-2,11H2,(H3,10,12,13) |
| InChIKey | JGYHUMYNISTHBO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.66 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |