C15H17Cl2N5 — CID 19149855
4-N-cyclopentyl-6-N-(2,4-dichlorophenyl)pyrimidine-4,5,6-triamine (PubChem CID 19149855) has the molecular formula C15H17Cl2N5 and a molecular weight of 338.24 g/mol. Its IUPAC name is 4-N-cyclopentyl-6-N-(2,4-dichlorophenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-cyclopentyl-6-N-(2,4-dichlorophenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19149855 |
| Molecular Formula | C15H17Cl2N5 |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 4-N-cyclopentyl-6-N-(2,4-dichlorophenyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(Nc2ccc(Cl)cc2Cl)ncnc1NC1CCCC1 |
| InChI | InChI=1S/C15H17Cl2N5/c16-9-5-6-12(11(17)7-9)22-15-13(18)14(19-8-20-15)21-10-3-1-2-4-10/h5-8,10H,1-4,18H2,(H2,19,20,21,22) |
| InChIKey | FXUWSSMXVLIGDD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |