C10H11N5O — CID 66282835
6-(2-methylbut-3-yn-2-ylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 66282835) has the molecular formula C10H11N5O and a molecular weight of 217.23 g/mol. Its IUPAC name is 6-(2-methylbut-3-yn-2-ylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 6-(2-methylbut-3-yn-2-ylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 66282835 |
| Molecular Formula | C10H11N5O |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 6-(2-methylbut-3-yn-2-ylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | C#CC(C)(C)Nc1ccc2n[nH]c(=O)n2n1 |
| InChI | InChI=1S/C10H11N5O/c1-4-10(2,3)11-7-5-6-8-12-13-9(16)15(8)14-7/h1,5-6H,2-3H3,(H,11,14)(H,13,16) |
| InChIKey | KEBCGYIJKKVJLP-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|