C12H18ClN5O — CID 114164358
6-[[2-(chloromethyl)-2-ethylbutyl]amino]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 114164358) has the molecular formula C12H18ClN5O and a molecular weight of 283.76 g/mol. Its IUPAC name is 6-[[2-(chloromethyl)-2-ethylbutyl]amino]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 6-[[2-(chloromethyl)-2-ethylbutyl]amino]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 114164358 |
| Molecular Formula | C12H18ClN5O |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 6-[[2-(chloromethyl)-2-ethylbutyl]amino]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | CCC(CC)(CCl)CNc1ccc2n[nH]c(=O)n2n1 |
| InChI | InChI=1S/C12H18ClN5O/c1-3-12(4-2,7-13)8-14-9-5-6-10-15-16-11(19)18(10)17-9/h5-6H,3-4,7-8H2,1-2H3,(H,14,17)(H,16,19) |
| InChIKey | WCIMLPNGDIVEFV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|