C8H12N6O3S — CID 66283992
N-[2-[(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]ethyl]methanesulfonamide (PubChem CID 66283992) has the molecular formula C8H12N6O3S and a molecular weight of 272.29 g/mol. Its IUPAC name is N-[2-[(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 66283992 |
| Molecular Formula | C8H12N6O3S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | N-[2-[(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNc1ccc2n[nH]c(=O)n2n1 |
| InChI | InChI=1S/C8H12N6O3S/c1-18(16,17)10-5-4-9-6-2-3-7-11-12-8(15)14(7)13-6/h2-3,10H,4-5H2,1H3,(H,9,13)(H,12,15) |
| InChIKey | FNFJIGCPXGPXLS-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|