C9H10N8O — CID 66283156
5-methyl-7-(1H-1,2,4-triazol-5-ylmethylamino)-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (PubChem CID 66283156) has the molecular formula C9H10N8O and a molecular weight of 246.23 g/mol. Its IUPAC name is 5-methyl-7-(1H-1,2,4-triazol-5-ylmethylamino)-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one.
| Compound Name | 5-methyl-7-(1H-1,2,4-triazol-5-ylmethylamino)-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
|---|---|
| PubChem CID | 66283156 |
| Molecular Formula | C9H10N8O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 5-methyl-7-(1H-1,2,4-triazol-5-ylmethylamino)-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| SMILES | Cc1nc(NCc2ncn[nH]2)cc2n[nH]c(=O)n12 |
| InChI | InChI=1S/C9H10N8O/c1-5-13-6(10-3-7-11-4-12-14-7)2-8-15-16-9(18)17(5)8/h2,4,10H,3H2,1H3,(H,16,18)(H,11,12,14) |
| InChIKey | BOVHRPVNYQCGQS-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |